![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Zootopia/ | 2020-01-26 10:29 | - | |
| Zombies/ | 2020-01-26 10:44 | - | |
| Zodiak/ | 2020-01-26 10:32 | - | |
| Yo gabba gabba/ | 2020-01-26 10:36 | - | |
| Yo-kai watch/ | 2020-01-26 10:49 | - | |
| X-men/ | 2020-01-26 10:38 | - | |
| World Wonders/ | 2020-01-26 10:33 | - | |
| Winx Club/ | 2020-01-26 10:42 | - | |
| Winx/ | 2020-01-26 10:35 | - | |
| WildAnimals/ | 2020-01-26 10:42 | - | |
| We Bare Bares/ | 2020-01-26 10:39 | - | |
| Warcraft/ | 2020-01-26 10:42 | - | |
| Wander Over Yonder/ | 2020-01-26 10:43 | - | |
| Vikings/ | 2020-01-26 10:44 | - | |
| Vampires/ | 2020-01-26 10:49 | - | |
| Valentines/ | 2020-01-26 10:46 | - | |
| Undertale/ | 2020-01-26 10:51 | - | |
| Trolls/ | 2020-01-26 10:38 | - | |
| Trees/ | 2020-01-26 10:39 | - | |
| Transformers/ | 2020-01-26 10:36 | - | |
| ToyStory/ | 2020-01-26 10:48 | - | |
| Tokyo Ghoul/ | 2020-01-26 10:31 | - | |
| Tokidoki/ | 2020-01-26 10:36 | - | |
| Tinkerbell/ | 2020-01-26 10:34 | - | |
| The Nut Job 2/ | 2020-01-26 10:41 | - | |
| The Loud House/ | 2020-01-26 10:32 | - | |
| The Lion Guard/ | 2020-01-26 10:39 | - | |
| TempleRun/ | 2020-01-26 10:41 | - | |
| Teen Titans/ | 2020-01-26 10:43 | - | |
| Taylor Swift/ | 2020-01-26 10:40 | - | |
| Tattoo wolves/ | 2020-01-26 10:42 | - | |
| Tattoo minimalist/ | 2020-01-26 10:51 | - | |
| Tattoo flowers/ | 2020-01-26 10:49 | - | |
| TattooTribal/ | 2020-01-26 10:46 | - | |
| TattooSkulls/ | 2020-01-26 10:49 | - | |
| Tattoo Old Schoo;/ | 2020-01-26 10:45 | - | |
| Tattoo Kenji/ | 2020-01-26 10:50 | - | |
| Tattoo Fonts/ | 2020-01-26 10:40 | - | |
| TattooDesigns/ | 2020-01-26 10:45 | - | |
| Tattoo Criminal/ | 2020-01-26 10:36 | - | |
| Tanks/ | 2020-01-26 10:48 | - | |
| Tangled/ | 2020-01-26 10:44 | - | |
| Sword art Online/ | 2020-01-26 10:40 | - | |
| Superheroes Women/ | 2020-01-26 10:47 | - | |
| Superheroes/ | 2020-01-26 10:45 | - | |
| Super Models/ | 2020-01-26 10:44 | - | |
| Super Mario/ | 2020-01-26 10:46 | - | |
| SuperAutos/ | 2020-01-26 10:36 | - | |
| Suicede Squard/ | 2020-01-26 10:35 | - | |
| SubwaySurfers/ | 2020-01-26 10:32 | - | |
| Steven Universe/ | 2020-01-26 10:41 | - | |
| Star vs. The Forces ..> | 2020-01-26 10:29 | - | |
| Stars and Constellat..> | 2020-01-26 10:36 | - | |
| StarWars/ | 2020-01-26 10:42 | - | |
| SpongeBob/ | 2020-01-26 10:33 | - | |
| SpaceShips/ | 2020-01-26 10:37 | - | |
| South Park/ | 2020-01-26 10:51 | - | |
| Sonik the Hedgehog/ | 2020-01-26 10:32 | - | |
| Snakes/ | 2020-01-26 10:34 | - | |
| Smurfs/ | 2020-01-26 10:50 | - | |
| Smiles/ | 2020-01-26 10:49 | - | |
| Slugterra/ | 2020-01-26 10:40 | - | |
| Skeletons/ | 2020-01-26 10:41 | - | |
| Sing/ | 2020-01-26 10:49 | - | |
| Simpsons/ | 2020-01-26 10:35 | - | |
| Shimmer and Shine/ | 2020-01-26 10:39 | - | |
| Sherlok Gnomes/ | 2020-01-26 10:46 | - | |
| Shaun the Sheep/ | 2020-01-26 10:46 | - | |
| Shadow Fight/ | 2020-01-26 10:39 | - | |
| Secret Life of Pets/ | 2020-01-26 10:34 | - | |
| SeaAnimals/ | 2020-01-26 10:51 | - | |
| Scooby Doo/ | 2020-01-26 10:33 | - | |
| Sausage Party/ | 2020-01-26 10:45 | - | |
| SailorMoon/ | 2020-01-26 10:47 | - | |
| Sago mini/ | 2020-01-26 10:49 | - | |
| Runes/ | 2020-01-26 10:41 | - | |
| Robots/ | 2020-01-26 10:49 | - | |
| Rick and Monty/ | 2020-01-26 10:40 | - | |
| Retro Cars/ | 2020-01-26 10:50 | - | |
| Regular Show/ | 2020-01-26 10:32 | - | |
| Rayman/ | 2020-01-26 10:36 | - | |
| RWBY Anime/ | 2020-01-26 10:44 | - | |
| Princesses/ | 2020-01-26 10:39 | - | |
| Power rangers/ | 2020-01-26 10:49 | - | |
| Powerpuff Girls/ | 2020-01-26 10:44 | - | |
| Pororo/ | 2020-01-26 10:45 | - | |
| Pokemons/ | 2020-01-26 10:36 | - | |
| PlantsvsZombies/ | 2020-01-26 10:42 | - | |
| PlanesCartoons/ | 2020-01-26 10:51 | - | |
| Pixel Superheroes/ | 2020-01-26 10:31 | - | |
| Pixel Minecraft/ | 2020-01-26 10:32 | - | |
| Pixel Cartoons/ | 2020-01-26 10:41 | - | |
| Pirates/ | 2020-01-26 10:36 | - | |
| Persona 5/ | 2020-01-26 10:50 | - | |
| PeppaPig/ | 2020-01-26 10:42 | - | |
| Paw Patrol/ | 2020-01-26 10:44 | - | |
| Panda Kung Fu/ | 2020-01-26 10:33 | - | |
| Paddington/ | 2020-01-26 10:29 | - | |
| PJ Masks/ | 2020-01-26 10:42 | - | |
| Overwatch/ | 2020-01-26 10:32 | - | |
| One Punch Man/ | 2020-01-26 10:51 | - | |
| OnePiece/ | 2020-01-26 10:44 | - | |
| One Direction/ | 2020-01-26 10:49 | - | |
| Octonauts/ | 2020-01-26 10:51 | - | |
| NinjaTurtles/ | 2020-01-26 10:40 | - | |
| Neighbours from hell/ | 2020-01-26 10:36 | - | |
| Naruto/ | 2020-01-26 10:43 | - | |
| Nail Art/ | 2020-01-26 10:49 | - | |
| NHL/ | 2020-01-26 10:40 | - | |
| NBA/ | 2020-01-26 10:38 | - | |
| My Superhero Pony/ | 2020-01-26 10:36 | - | |
| My Star Wars Pony/ | 2020-01-26 10:40 | - | |
| MySingingMonsters/ | 2020-01-26 10:45 | - | |
| MyLittlePony/ | 2020-01-26 10:37 | - | |
| My Fairy Pony/ | 2020-01-26 10:44 | - | |
| Musical Instruments/ | 2020-01-26 10:49 | - | |
| Moxie Girls/ | 2020-01-26 10:43 | - | |
| Monsters/ | 2020-01-26 10:46 | - | |
| Monster Trucks/ | 2020-01-26 10:46 | - | |
| Monster Pony/ | 2020-01-26 10:47 | - | |
| MonsterHigh/ | 2020-01-26 10:41 | - | |
| Monster Dolls/ | 2020-01-26 10:29 | - | |
| Moana/ | 2020-01-26 10:47 | - | |
| Minecraft/ | 2020-01-26 10:49 | - | |
| Mermaids/ | 2020-01-26 10:41 | - | |
| Masha and the Bear/ | 2020-01-26 10:38 | - | |
| Manadala/ | 2020-01-26 10:47 | - | |
| Makeup/ | 2020-01-26 10:29 | - | |
| Madagascar Penguins/ | 2020-01-26 10:46 | - | |
| Luntik/ | 2020-01-26 10:49 | - | |
| Little Einsteins/ | 2020-01-26 10:40 | - | |
| LegoSuperHeroes/ | 2020-01-26 10:38 | - | |
| LegoStarwars/ | 2020-01-26 10:40 | - | |
| Lego Simpsons/ | 2020-01-26 10:35 | - | |
| LegoNinjago/ | 2020-01-26 10:42 | - | |
| Lego Movie/ | 2020-01-26 10:38 | - | |
| Lego Mixels/ | 2020-01-26 10:36 | - | |
| Lego Minecraft/ | 2020-01-26 10:33 | - | |
| Lego Jurassic World/ | 2020-01-26 10:50 | - | |
| Lego Hobbit/ | 2020-01-26 10:45 | - | |
| Lego Harry Potter/ | 2020-01-26 10:45 | - | |
| Lego Friends/ | 2020-01-26 10:50 | - | |
| Lego Elves/ | 2020-01-26 10:47 | - | |
| Lego City/ | 2020-01-26 10:42 | - | |
| Lego Chima/ | 2020-01-26 10:44 | - | |
| Lego Bionicle/ | 2020-01-26 10:35 | - | |
| Lego Batman Movie/ | 2020-01-26 10:32 | - | |
| Lalaloopsy/ | 2020-01-26 10:42 | - | |
| Ladybug and Cat Noir/ | 2020-01-26 10:48 | - | |
| LPS/ | 2020-01-26 10:42 | - | |
| LOL/ | 2020-01-26 10:48 | - | |
| Kubo and the Two Str..> | 2020-01-26 10:34 | - | |
| Knights/ | 2020-01-26 10:49 | - | |
| Kingsglaive Final Fa..> | 2020-01-26 10:29 | - | |
| Kikoriki/ | 2020-01-26 10:33 | - | |
| KidsDraw/ | 2020-01-26 10:40 | - | |
| Kawaii/ | 2020-01-26 10:31 | - | |
| Jurassic Dinosaurs/ | 2020-01-26 10:33 | - | |
| Inside Out/ | 2020-01-26 10:34 | - | |
| Insects/ | 2020-01-26 10:42 | - | |
| Ice Age/ | 2020-01-26 10:45 | - | |
| Hotel Transylvania/ | 2020-01-26 10:41 | - | |
| Hot Wheels/ | 2020-01-26 10:35 | - | |
| Horses and Unicorns/ | 2020-01-26 10:41 | - | |
| Horses/ | 2020-01-26 10:49 | - | |
| Hiarstyles/ | 2020-01-26 10:31 | - | |
| Henna Tattoo/ | 2020-01-26 10:45 | - | |
| Hearts/ | 2020-01-26 10:39 | - | |
| HayDay/ | 2020-01-26 10:39 | - | |
| Hats/ | 2020-01-26 10:46 | - | |
| Halloween/ | 2020-01-26 10:48 | - | |
| Hair and Hairstyles/ | 2020-01-26 10:49 | - | |
| GunsandPistols/ | 2020-01-26 10:34 | - | |
| Gumball/ | 2020-01-26 10:49 | - | |
| Guardian of the Moon/ | 2020-01-26 10:41 | - | |
| Gravity Falls/ | 2020-01-26 10:44 | - | |
| Graffiti/ | 2020-01-26 10:48 | - | |
| Girl Meets World/ | 2020-01-26 10:40 | - | |
| Gintama/ | 2020-01-26 10:31 | - | |
| Ghost in the Shell/ | 2020-01-26 10:45 | - | |
| Geometric Animals/ | 2020-01-26 10:40 | - | |
| GameofThrones/ | 2020-01-26 10:51 | - | |
| Galaxy Guardians/ | 2020-01-26 10:38 | - | |
| GTA/ | 2020-01-26 10:43 | - | |
| Futurama/ | 2020-01-26 10:39 | - | |
| Furry/ | 2020-01-26 10:35 | - | |
| Fullmetal Alchemist/ | 2020-01-26 10:45 | - | |
| Fruits/ | 2020-01-26 10:35 | - | |
| Frozen/ | 2020-01-26 10:43 | - | |
| Food/ | 2020-01-26 10:46 | - | |
| Flowers/ | 2020-01-26 10:40 | - | |
| Flapjack/ | 2020-01-26 10:42 | - | |
| Fixiki/ | 2020-01-26 10:31 | - | |
| Five nights at freddys/ | 2020-01-26 10:38 | - | |
| Final Fantasy/ | 2020-01-26 10:36 | - | |
| Farm Heroes Saga/ | 2020-01-26 10:41 | - | |
| FarmAnimals/ | 2020-01-26 10:43 | - | |
| FamousSingers/ | 2020-01-26 10:38 | - | |
| FamousActors/ | 2020-01-26 10:37 | - | |
| Family Guy/ | 2020-01-26 10:44 | - | |
| Fallout4/ | 2020-01-26 10:43 | - | |
| FairyTail/ | 2020-01-26 10:41 | - | |
| Fairies/ | 2020-01-26 10:35 | - | |
| Face Masks/ | 2020-01-26 10:46 | - | |
| FIFA/ | 2020-01-26 10:31 | - | |
| EverAfterHigh/ | 2020-01-26 10:47 | - | |
| EquestriaGirls/ | 2020-01-26 10:40 | - | |
| Emotions/ | 2020-01-26 10:40 | - | |
| Emoji Movie/ | 2020-01-26 10:49 | - | |
| Elves/ | 2020-01-26 10:51 | - | |
| Easter/ | 2020-01-26 10:43 | - | |
| Dresses for girls/ | 2020-01-26 10:38 | - | |
| Dragons/ | 2020-01-26 10:44 | - | |
| Dragon mania legends/ | 2020-01-26 10:43 | - | |
| Dory and Nemo/ | 2020-01-26 10:44 | - | |
| Dora and Friends/ | 2020-01-26 10:48 | - | |
| Dora/ | 2020-01-26 10:35 | - | |
| Dogs/ | 2020-01-26 10:47 | - | |
| Disney Tsum Tsum/ | 2020-01-26 10:36 | - | |
| Dinos/ | 2020-01-26 10:39 | - | |
| Destiny/ | 2020-01-26 10:42 | - | |
| Desserts/ | 2020-01-26 10:49 | - | |
| DespicableMe/ | 2020-01-26 10:46 | - | |
| Despicable Me/ | 2020-01-26 10:49 | - | |
| Deers/ | 2020-01-26 10:41 | - | |
| DeathNote/ | 2020-01-26 10:47 | - | |
| DBZ/ | 2020-01-26 10:45 | - | |
| Cute Angels/ | 2020-01-26 10:44 | - | |
| ColdArms/ | 2020-01-26 10:39 | - | |
| Cold Arms/ | 2020-01-26 10:41 | - | |
| Code Geass/ | 2020-01-26 10:39 | - | |
| Coctails/ | 2020-01-26 10:51 | - | |
| Coco/ | 2020-01-26 10:34 | - | |
| Clothes/ | 2020-01-26 10:34 | - | |
| ClashofClans/ | 2020-01-26 10:49 | - | |
| Cinderella/ | 2020-01-26 10:44 | - | |
| Chowder/ | 2020-01-26 10:38 | - | |
| Chibi Superheroes/ | 2020-01-26 10:35 | - | |
| ChibiStarWars/ | 2020-01-26 10:44 | - | |
| ChibiMinecraft/ | 2020-01-26 10:43 | - | |
| Chibi LOL/ | 2020-01-26 10:44 | - | |
| Chibi Characters/ | 2020-01-26 10:35 | - | |
| Chibi/ | 2020-01-26 10:39 | - | |
| Chi Chi Love Pets/ | 2020-01-26 10:40 | - | |
| CelebritiesMileyCyrus/ | 2020-01-26 10:43 | - | |
| CelebritiesJustinBie..> | 2020-01-26 10:41 | - | |
| Celebrities Cristian..> | 2020-01-26 10:36 | - | |
| Celebrities/ | 2020-01-26 10:50 | - | |
| Cats Superheroes/ | 2020-01-26 10:40 | - | |
| Cats/ | 2020-01-26 10:42 | - | |
| CartoonsCharacters/ | 2020-01-26 10:31 | - | |
| Cartoon Christmas/ | 2020-01-26 10:31 | - | |
| Cars/ | 2020-01-26 10:50 | - | |
| Cars (Disney)/ | 2020-01-26 10:46 | - | |
| Captain Underpants/ | 2020-01-26 10:31 | - | |
| CandyCrush/ | 2020-01-26 10:41 | - | |
| Butterfly/ | 2020-01-26 10:40 | - | |
| Bratz/ | 2020-01-26 10:46 | - | |
| Boruto/ | 2020-01-26 10:44 | - | |
| Boovs/ | 2020-01-26 10:51 | - | |
| Boom Beach/ | 2020-01-26 10:48 | - | |
| Book of Jungle/ | 2020-01-26 10:49 | - | |
| Bleach/ | 2020-01-26 10:42 | - | |
| Blaze and Monster Ma..> | 2020-01-26 10:47 | - | |
| Birds/ | 2020-01-26 10:50 | - | |
| Best Fiends/ | 2020-01-26 10:46 | - | |
| Ben and Holly Little..> | 2020-01-26 10:35 | - | |
| Ben10/ | 2020-01-26 10:49 | - | |
| BaseballLogos/ | 2020-01-26 10:38 | - | |
| Bangtan Boys/ | 2020-01-26 10:40 | - | |
| Band Logos/ | 2020-01-26 10:42 | - | |
| Ballerina/ | 2020-01-26 10:44 | - | |
| Baby Boss/ | 2020-01-26 10:36 | - | |
| Baby Animals/ | 2020-01-26 10:44 | - | |
| Avatar Aang/ | 2020-01-26 10:39 | - | |
| Attack on Titan Manga/ | 2020-01-26 10:35 | - | |
| Asterix and Obelix/ | 2020-01-26 10:41 | - | |
| Archer/ | 2020-01-26 10:43 | - | |
| AnimeManga/ | 2020-01-26 10:44 | - | |
| Anime Girls/ | 2020-01-26 10:51 | - | |
| Anime Celebrities/ | 2020-01-26 10:45 | - | |
| AnimeAnimals/ | 2020-01-26 10:33 | - | |
| Animal Jam/ | 2020-01-26 10:48 | - | |
| AngryBirds/ | 2020-01-26 10:43 | - | |
| Angels/ | 2020-01-26 10:43 | - | |
| Alvin and The Chipmu..> | 2020-01-26 10:51 | - | |
| Alphabet for Kids/ | 2020-01-26 10:41 | - | |
| Alice in wonderland/ | 2020-01-26 10:41 | - | |
| AdventureTimes/ | 2020-01-26 10:32 | - | |
| 3D Objects/ | 2020-01-26 10:40 | - | |
| 3D Letters/ | 2020-01-26 10:41 | - | |